C15H14ClNO4S — CID 121397311
3-(5-chloro-1,3-thiazol-2-yl)-5-(oxan-4-yloxy)benzoic acid (PubChem CID 121397311) has the molecular formula C15H14ClNO4S and a molecular weight of 339.80 g/mol. Its IUPAC name is 3-(5-chloro-1,3-thiazol-2-yl)-5-(oxan-4-yloxy)benzoic acid.
| Compound Name | 3-(5-chloro-1,3-thiazol-2-yl)-5-(oxan-4-yloxy)benzoic acid |
|---|---|
| PubChem CID | 121397311 |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 3-(5-chloro-1,3-thiazol-2-yl)-5-(oxan-4-yloxy)benzoic acid |
| SMILES | O=C(O)c1cc(OC2CCOCC2)cc(-c2ncc(Cl)s2)c1 |
| InChI | InChI=1S/C15H14ClNO4S/c16-13-8-17-14(22-13)9-5-10(15(18)19)7-12(6-9)21-11-1-3-20-4-2-11/h5-8,11H,1-4H2,(H,18,19) |
| InChIKey | OJOFFUIHIAUWHG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |