C24H25N5O3S — CID 121399516
2-[[4-[5-[6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]ethanol (PubChem CID 121399516) has the molecular formula C24H25N5O3S and a molecular weight of 463.56 g/mol. Its IUPAC name is 2-[[4-[5-[6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]ethanol.
| Compound Name | 2-[[4-[5-[6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 121399516 |
| Molecular Formula | C24H25N5O3S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-[[4-[5-[6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]ethanol |
| SMILES | CC(C)S(=O)c1ccc(-c2cncc(-c3nnc(-c4ccc(CNCCO)cc4)o3)n2)cc1 |
| InChI | InChI=1S/C24H25N5O3S/c1-16(2)33(31)20-9-7-18(8-10-20)21-14-26-15-22(27-21)24-29-28-23(32-24)19-5-3-17(4-6-19)13-25-11-12-30/h3-10,14-16,25,30H,11-13H2,1-2H3 |
| InChIKey | MKLPCQYBCGIYKO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 114.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|