C20H24N4O3S — CID 121399781
N-[[4-(5-aminopentanoylamino)phenyl]carbamothioyl]-3-methoxybenzamide (PubChem CID 121399781) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[[4-(5-aminopentanoylamino)phenyl]carbamothioyl]-3-methoxybenzamide.
| Compound Name | N-[[4-(5-aminopentanoylamino)phenyl]carbamothioyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 121399781 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[[4-(5-aminopentanoylamino)phenyl]carbamothioyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC(=S)Nc2ccc(NC(=O)CCCCN)cc2)c1 |
| InChI | InChI=1S/C20H24N4O3S/c1-27-17-6-4-5-14(13-17)19(26)24-20(28)23-16-10-8-15(9-11-16)22-18(25)7-2-3-12-21/h4-6,8-11,13H,2-3,7,12,21H2,1H3,(H,22,25)(H2,23,24,26,28) |
| InChIKey | NYIUWFODLWABGK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|