C24H21ClN5O7PS — CID 121399808
N-[9-[(4aR,6R)-2-(2-chlorophenoxy)-7-hydroxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]purin-6-yl]-4-methoxybenzamide (PubChem CID 121399808) has the molecular formula C24H21ClN5O7PS and a molecular weight of 589.95 g/mol. Its IUPAC name is N-[9-[(4aR,6R)-2-(2-chlorophenoxy)-7-hydroxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]purin-6-yl]-4-methoxybenzamide.
| Compound Name | N-[9-[(4aR,6R)-2-(2-chlorophenoxy)-7-hydroxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]purin-6-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 121399808 |
| Molecular Formula | C24H21ClN5O7PS |
| Molecular Weight | 589.95 g/mol |
| Exact Mass | 589.06 |
| IUPAC Name | N-[9-[(4aR,6R)-2-(2-chlorophenoxy)-7-hydroxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]purin-6-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ncnc3c2ncn3[C@@H]2O[C@@H]3COP(=S)(Oc4ccccc4Cl)OC3C2O)cc1 |
| InChI | InChI=1S/C24H21ClN5O7PS/c1-33-14-8-6-13(7-9-14)23(32)29-21-18-22(27-11-26-21)30(12-28-18)24-19(31)20-17(35-24)10-34-38(39,37-20)36-16-5-3-2-4-15(16)25/h2-9,11-12,17,19-20,24,31H,10H2,1H3,(H,26,27,29,32)/t17-,19?,20?,24-,38?/m1/s1 |
| InChIKey | HHPZZBWDTSBVSY-MVNZWRASSA-N |
| XLogP | 3.72 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.95 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|