C25H26N6 — CID 121405390
(2S)-1-N,2-N-bis[(4-pyrimidin-2-ylphenyl)methyl]propane-1,2-diamine (PubChem CID 121405390) has the molecular formula C25H26N6 and a molecular weight of 410.53 g/mol. Its IUPAC name is (2S)-1-N,2-N-bis[(4-pyrimidin-2-ylphenyl)methyl]propane-1,2-diamine.
| Compound Name | (2S)-1-N,2-N-bis[(4-pyrimidin-2-ylphenyl)methyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 121405390 |
| Molecular Formula | C25H26N6 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (2S)-1-N,2-N-bis[(4-pyrimidin-2-ylphenyl)methyl]propane-1,2-diamine |
| SMILES | C[C@@H](CNCc1ccc(-c2ncccn2)cc1)NCc1ccc(-c2ncccn2)cc1 |
| InChI | InChI=1S/C25H26N6/c1-19(31-18-21-6-10-23(11-7-21)25-29-14-3-15-30-25)16-26-17-20-4-8-22(9-5-20)24-27-12-2-13-28-24/h2-15,19,26,31H,16-18H2,1H3/t19-/m0/s1 |
| InChIKey | NTRMWPIVPVDKSB-IBGZPJMESA-N |
| XLogP | 3.87 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |