C17H25N3O4 — CID 154907219
formic acid;4-methoxy-4-methyl-N-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]pentan-2-amine (PubChem CID 154907219) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is formic acid;4-methoxy-4-methyl-N-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]pentan-2-amine.
| Compound Name | formic acid;4-methoxy-4-methyl-N-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]pentan-2-amine |
|---|---|
| PubChem CID | 154907219 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | formic acid;4-methoxy-4-methyl-N-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]pentan-2-amine |
| SMILES | COC(C)(C)CC(C)NCc1ccc(-c2ncon2)cc1.O=CO |
| InChI | InChI=1S/C16H23N3O2.CH2O2/c1-12(9-16(2,3)20-4)17-10-13-5-7-14(8-6-13)15-18-11-21-19-15;2-1-3/h5-8,11-12,17H,9-10H2,1-4H3;1H,(H,2,3) |
| InChIKey | FKYBIOXNRNSMSI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|