C19H28N4O5 — CID 154908701
formic acid;N-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]-1-propylpiperidin-4-amine (PubChem CID 154908701) has the molecular formula C19H28N4O5 and a molecular weight of 392.46 g/mol. Its IUPAC name is formic acid;N-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]-1-propylpiperidin-4-amine.
| Compound Name | formic acid;N-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]-1-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 154908701 |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | formic acid;N-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]-1-propylpiperidin-4-amine |
| SMILES | CCCN1CCC(NCc2ccc(-c3ncon3)cc2)CC1.O=CO.O=CO |
| InChI | InChI=1S/C17H24N4O.2CH2O2/c1-2-9-21-10-7-16(8-11-21)18-12-14-3-5-15(6-4-14)17-19-13-22-20-17;2*2-1-3/h3-6,13,16,18H,2,7-12H2,1H3;2*1H,(H,2,3) |
| InChIKey | PEPKWXZCLZKSNJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|