C19H30N2O — CID 143221470
N-(1-benzofuran-5-ylmethyl)-1-propylpiperidin-4-amine;ethane (PubChem CID 143221470) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is N-(1-benzofuran-5-ylmethyl)-1-propylpiperidin-4-amine;ethane.
| Compound Name | N-(1-benzofuran-5-ylmethyl)-1-propylpiperidin-4-amine;ethane |
|---|---|
| PubChem CID | 143221470 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | N-(1-benzofuran-5-ylmethyl)-1-propylpiperidin-4-amine;ethane |
| SMILES | CC.CCCN1CCC(NCc2ccc3occc3c2)CC1 |
| InChI | InChI=1S/C17H24N2O.C2H6/c1-2-8-19-9-5-16(6-10-19)18-13-14-3-4-17-15(12-14)7-11-20-17;1-2/h3-4,7,11-12,16,18H,2,5-6,8-10,13H2,1H3;1-2H3 |
| InChIKey | VZOYYNYRUGDZFF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |