C21H35N3O — CID 97230593
N-[[3-[[(2R)-2-methylmorpholin-4-yl]methyl]phenyl]methyl]-1-propylpiperidin-4-amine (PubChem CID 97230593) has the molecular formula C21H35N3O and a molecular weight of 345.53 g/mol. Its IUPAC name is N-[[3-[[(2R)-2-methylmorpholin-4-yl]methyl]phenyl]methyl]-1-propylpiperidin-4-amine.
| Compound Name | N-[[3-[[(2R)-2-methylmorpholin-4-yl]methyl]phenyl]methyl]-1-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 97230593 |
| Molecular Formula | C21H35N3O |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | N-[[3-[[(2R)-2-methylmorpholin-4-yl]methyl]phenyl]methyl]-1-propylpiperidin-4-amine |
| SMILES | CCCN1CCC(NCc2cccc(CN3CCO[C@H](C)C3)c2)CC1 |
| InChI | InChI=1S/C21H35N3O/c1-3-9-23-10-7-21(8-11-23)22-15-19-5-4-6-20(14-19)17-24-12-13-25-18(2)16-24/h4-6,14,18,21-22H,3,7-13,15-17H2,1-2H3/t18-/m1/s1 |
| InChIKey | IYDMQPMIYXIYKN-GOSISDBHSA-N |
| XLogP | 2.87 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |