C15H25ClN4O2 — CID 121409085
5-[2-(dimethylamino)ethoxy]-6-piperidin-4-ylpyridine-2-carboxamide;hydrochloride (PubChem CID 121409085) has the molecular formula C15H25ClN4O2 and a molecular weight of 328.84 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethoxy]-6-piperidin-4-ylpyridine-2-carboxamide;hydrochloride.
| Compound Name | 5-[2-(dimethylamino)ethoxy]-6-piperidin-4-ylpyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 121409085 |
| Molecular Formula | C15H25ClN4O2 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 5-[2-(dimethylamino)ethoxy]-6-piperidin-4-ylpyridine-2-carboxamide;hydrochloride |
| SMILES | CN(C)CCOc1ccc(C(N)=O)nc1C1CCNCC1.Cl |
| InChI | InChI=1S/C15H24N4O2.ClH/c1-19(2)9-10-21-13-4-3-12(15(16)20)18-14(13)11-5-7-17-8-6-11;/h3-4,11,17H,5-10H2,1-2H3,(H2,16,20);1H |
| InChIKey | AMXKWDASPGAYBX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |