C19H15BrN6O2S — CID 121416216
N-[5-[5-[(6-bromoquinazolin-4-yl)amino]-3-pyridinyl]-3-pyridinyl]methanesulfonamide (PubChem CID 121416216) has the molecular formula C19H15BrN6O2S and a molecular weight of 471.34 g/mol. Its IUPAC name is N-[5-[5-[(6-bromoquinazolin-4-yl)amino]-3-pyridinyl]-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[5-[5-[(6-bromoquinazolin-4-yl)amino]-3-pyridinyl]-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 121416216 |
| Molecular Formula | C19H15BrN6O2S |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | N-[5-[5-[(6-bromoquinazolin-4-yl)amino]-3-pyridinyl]-3-pyridinyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cncc(-c2cncc(Nc3ncnc4ccc(Br)cc34)c2)c1 |
| InChI | InChI=1S/C19H15BrN6O2S/c1-29(27,28)26-16-5-13(8-22-10-16)12-4-15(9-21-7-12)25-19-17-6-14(20)2-3-18(17)23-11-24-19/h2-11,26H,1H3,(H,23,24,25) |
| InChIKey | GTGIMSZTWVSALF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |