C22H18Cl2N4O2S — CID 158691583
N-[2-chloro-5-[4-(3-chloro-4-methylanilino)quinazolin-6-yl]phenyl]methanesulfonamide (PubChem CID 158691583) has the molecular formula C22H18Cl2N4O2S and a molecular weight of 473.39 g/mol. Its IUPAC name is N-[2-chloro-5-[4-(3-chloro-4-methylanilino)quinazolin-6-yl]phenyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-[4-(3-chloro-4-methylanilino)quinazolin-6-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 158691583 |
| Molecular Formula | C22H18Cl2N4O2S |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | N-[2-chloro-5-[4-(3-chloro-4-methylanilino)quinazolin-6-yl]phenyl]methanesulfonamide |
| SMILES | Cc1ccc(Nc2ncnc3ccc(-c4ccc(Cl)c(NS(C)(=O)=O)c4)cc23)cc1Cl |
| InChI | InChI=1S/C22H18Cl2N4O2S/c1-13-3-6-16(11-19(13)24)27-22-17-9-14(5-8-20(17)25-12-26-22)15-4-7-18(23)21(10-15)28-31(2,29)30/h3-12,28H,1-2H3,(H,25,26,27) |
| InChIKey | HSTJRQBLCYOPQT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |