C17H18ClN5O — CID 121416447
4-[[5-chloro-1-(2-methyl-4-pyridinyl)pyrazolo[3,4-c]pyridin-7-yl]methyl]morpholine (PubChem CID 121416447) has the molecular formula C17H18ClN5O and a molecular weight of 343.82 g/mol. Its IUPAC name is 4-[[5-chloro-1-(2-methyl-4-pyridinyl)pyrazolo[3,4-c]pyridin-7-yl]methyl]morpholine.
| Compound Name | 4-[[5-chloro-1-(2-methyl-4-pyridinyl)pyrazolo[3,4-c]pyridin-7-yl]methyl]morpholine |
|---|---|
| PubChem CID | 121416447 |
| Molecular Formula | C17H18ClN5O |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-[[5-chloro-1-(2-methyl-4-pyridinyl)pyrazolo[3,4-c]pyridin-7-yl]methyl]morpholine |
| SMILES | Cc1cc(-n2ncc3cc(Cl)nc(CN4CCOCC4)c32)ccn1 |
| InChI | InChI=1S/C17H18ClN5O/c1-12-8-14(2-3-19-12)23-17-13(10-20-23)9-16(18)21-15(17)11-22-4-6-24-7-5-22/h2-3,8-10H,4-7,11H2,1H3 |
| InChIKey | WTRSBZXJCFCQFU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|