C9H13ClN4O — CID 105486071
4-chloro-6-(morpholin-4-ylmethyl)pyrimidin-2-amine (PubChem CID 105486071) has the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. Its IUPAC name is 4-chloro-6-(morpholin-4-ylmethyl)pyrimidin-2-amine.
| Compound Name | 4-chloro-6-(morpholin-4-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 105486071 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 4-chloro-6-(morpholin-4-ylmethyl)pyrimidin-2-amine |
| SMILES | Nc1nc(Cl)cc(CN2CCOCC2)n1 |
| InChI | InChI=1S/C9H13ClN4O/c10-8-5-7(12-9(11)13-8)6-14-1-3-15-4-2-14/h5H,1-4,6H2,(H2,11,12,13) |
| InChIKey | ZHQLNGXPGOTSRO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |