C15H25N3O — CID 138579238
4-[[2,6-di(propan-2-yl)pyrimidin-4-yl]methyl]morpholine (PubChem CID 138579238) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-[[2,6-di(propan-2-yl)pyrimidin-4-yl]methyl]morpholine.
| Compound Name | 4-[[2,6-di(propan-2-yl)pyrimidin-4-yl]methyl]morpholine |
|---|---|
| PubChem CID | 138579238 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 4-[[2,6-di(propan-2-yl)pyrimidin-4-yl]methyl]morpholine |
| SMILES | CC(C)c1cc(CN2CCOCC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C15H25N3O/c1-11(2)14-9-13(16-15(17-14)12(3)4)10-18-5-7-19-8-6-18/h9,11-12H,5-8,10H2,1-4H3 |
| InChIKey | AAIUBBHWTWVZFV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |