C21H19FN6O2 — CID 121416668
1-[2-(4-fluorophenoxy)ethyl]-3-[1-(2-methyl-4-pyridinyl)pyrazolo[3,4-c]pyridin-5-yl]urea (PubChem CID 121416668) has the molecular formula C21H19FN6O2 and a molecular weight of 406.42 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)ethyl]-3-[1-(2-methyl-4-pyridinyl)pyrazolo[3,4-c]pyridin-5-yl]urea.
| Compound Name | 1-[2-(4-fluorophenoxy)ethyl]-3-[1-(2-methyl-4-pyridinyl)pyrazolo[3,4-c]pyridin-5-yl]urea |
|---|---|
| PubChem CID | 121416668 |
| Molecular Formula | C21H19FN6O2 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)ethyl]-3-[1-(2-methyl-4-pyridinyl)pyrazolo[3,4-c]pyridin-5-yl]urea |
| SMILES | Cc1cc(-n2ncc3cc(NC(=O)NCCOc4ccc(F)cc4)ncc32)ccn1 |
| InChI | InChI=1S/C21H19FN6O2/c1-14-10-17(6-7-23-14)28-19-13-25-20(11-15(19)12-26-28)27-21(29)24-8-9-30-18-4-2-16(22)3-5-18/h2-7,10-13H,8-9H2,1H3,(H2,24,25,27,29) |
| InChIKey | RZEYVJJNGWYKAX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|