C21H25ClFNO3 — CID 121418386
4-(4-chlorophenoxy)-1-[2-(5-fluoro-2-methoxyphenoxy)ethyl]-4-methylpiperidine (PubChem CID 121418386) has the molecular formula C21H25ClFNO3 and a molecular weight of 393.89 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-1-[2-(5-fluoro-2-methoxyphenoxy)ethyl]-4-methylpiperidine.
| Compound Name | 4-(4-chlorophenoxy)-1-[2-(5-fluoro-2-methoxyphenoxy)ethyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 121418386 |
| Molecular Formula | C21H25ClFNO3 |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 4-(4-chlorophenoxy)-1-[2-(5-fluoro-2-methoxyphenoxy)ethyl]-4-methylpiperidine |
| SMILES | COc1ccc(F)cc1OCCN1CCC(C)(Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H25ClFNO3/c1-21(27-18-6-3-16(22)4-7-18)9-11-24(12-10-21)13-14-26-20-15-17(23)5-8-19(20)25-2/h3-8,15H,9-14H2,1-2H3 |
| InChIKey | SLHMFRSOAYRAIB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |