C21H24ClNO2 — CID 121430055
3-(4-chlorophenoxy)-1-[2-(3-ethenylphenoxy)ethyl]-3-methylpyrrolidine (PubChem CID 121430055) has the molecular formula C21H24ClNO2 and a molecular weight of 357.88 g/mol. Its IUPAC name is 3-(4-chlorophenoxy)-1-[2-(3-ethenylphenoxy)ethyl]-3-methylpyrrolidine.
| Compound Name | 3-(4-chlorophenoxy)-1-[2-(3-ethenylphenoxy)ethyl]-3-methylpyrrolidine |
|---|---|
| PubChem CID | 121430055 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-(4-chlorophenoxy)-1-[2-(3-ethenylphenoxy)ethyl]-3-methylpyrrolidine |
| SMILES | C=Cc1cccc(OCCN2CCC(C)(Oc3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C21H24ClNO2/c1-3-17-5-4-6-20(15-17)24-14-13-23-12-11-21(2,16-23)25-19-9-7-18(22)8-10-19/h3-10,15H,1,11-14,16H2,2H3 |
| InChIKey | ORWAQVYUFONBQB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |