C22H32N2O3 — CID 145107874
ethane;3-methoxy-4-[3-methyl-1-(2-phenoxyethyl)pyrrolidin-3-yl]oxyaniline (PubChem CID 145107874) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is ethane;3-methoxy-4-[3-methyl-1-(2-phenoxyethyl)pyrrolidin-3-yl]oxyaniline.
| Compound Name | ethane;3-methoxy-4-[3-methyl-1-(2-phenoxyethyl)pyrrolidin-3-yl]oxyaniline |
|---|---|
| PubChem CID | 145107874 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | ethane;3-methoxy-4-[3-methyl-1-(2-phenoxyethyl)pyrrolidin-3-yl]oxyaniline |
| SMILES | CC.COc1cc(N)ccc1OC1(C)CCN(CCOc2ccccc2)C1 |
| InChI | InChI=1S/C20H26N2O3.C2H6/c1-20(25-18-9-8-16(21)14-19(18)23-2)10-11-22(15-20)12-13-24-17-6-4-3-5-7-17;1-2/h3-9,14H,10-13,15,21H2,1-2H3;1-2H3 |
| InChIKey | ODTKBQAZERCXCL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|