C12H22F2O — CID 121421960
4-(difluoromethyl)-3,4-di(propan-2-yl)oxane (PubChem CID 121421960) has the molecular formula C12H22F2O and a molecular weight of 220.30 g/mol. Its IUPAC name is 4-(difluoromethyl)-3,4-di(propan-2-yl)oxane.
| Compound Name | 4-(difluoromethyl)-3,4-di(propan-2-yl)oxane |
|---|---|
| PubChem CID | 121421960 |
| Molecular Formula | C12H22F2O |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-(difluoromethyl)-3,4-di(propan-2-yl)oxane |
| SMILES | CC(C)C1COCCC1(C(C)C)C(F)F |
| InChI | InChI=1S/C12H22F2O/c1-8(2)10-7-15-6-5-12(10,9(3)4)11(13)14/h8-11H,5-7H2,1-4H3 |
| InChIKey | GHHKDRRBZIIKIN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |