C15H17N3O3S2 — CID 1214242
1-[(2-methoxyphenyl)methyl]-3-(4-sulfamoylphenyl)thiourea (PubChem CID 1214242) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 1214242 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-3-(4-sulfamoylphenyl)thiourea |
| SMILES | COc1ccccc1CNC(=S)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H17N3O3S2/c1-21-14-5-3-2-4-11(14)10-17-15(22)18-12-6-8-13(9-7-12)23(16,19)20/h2-9H,10H2,1H3,(H2,16,19,20)(H2,17,18,22) |
| InChIKey | QRKNYINSBXBIGH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|