C20H22ClFN2O2 — CID 121425475
[(3R)-1-ethylpyrrolidin-3-yl]methyl N-[2-(3-chloro-4-fluorophenyl)phenyl]carbamate (PubChem CID 121425475) has the molecular formula C20H22ClFN2O2 and a molecular weight of 376.86 g/mol. Its IUPAC name is [(3R)-1-ethylpyrrolidin-3-yl]methyl N-[2-(3-chloro-4-fluorophenyl)phenyl]carbamate.
| Compound Name | [(3R)-1-ethylpyrrolidin-3-yl]methyl N-[2-(3-chloro-4-fluorophenyl)phenyl]carbamate |
|---|---|
| PubChem CID | 121425475 |
| Molecular Formula | C20H22ClFN2O2 |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [(3R)-1-ethylpyrrolidin-3-yl]methyl N-[2-(3-chloro-4-fluorophenyl)phenyl]carbamate |
| SMILES | CCN1CC[C@@H](COC(=O)Nc2ccccc2-c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C20H22ClFN2O2/c1-2-24-10-9-14(12-24)13-26-20(25)23-19-6-4-3-5-16(19)15-7-8-18(22)17(21)11-15/h3-8,11,14H,2,9-10,12-13H2,1H3,(H,23,25)/t14-/m1/s1 |
| InChIKey | CLCWQIRRUIBZQH-CQSZACIVSA-N |
| XLogP | 5.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |