C23H27BrClFN2O4 — CID 170649843
ethyl 2-[(2S)-2-[[2-(3-chloro-4-fluorophenyl)phenyl]carbamoyloxymethyl]-1-methylpyrrolidin-1-ium-1-yl]acetate bromide (PubChem CID 170649843) has the molecular formula C23H27BrClFN2O4 and a molecular weight of 529.83 g/mol. Its IUPAC name is ethyl 2-[(2S)-2-[[2-(3-chloro-4-fluorophenyl)phenyl]carbamoyloxymethyl]-1-methylpyrrolidin-1-ium-1-yl]acetate bromide.
| Compound Name | ethyl 2-[(2S)-2-[[2-(3-chloro-4-fluorophenyl)phenyl]carbamoyloxymethyl]-1-methylpyrrolidin-1-ium-1-yl]acetate bromide |
|---|---|
| PubChem CID | 170649843 |
| Molecular Formula | C23H27BrClFN2O4 |
| Molecular Weight | 529.83 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | ethyl 2-[(2S)-2-[[2-(3-chloro-4-fluorophenyl)phenyl]carbamoyloxymethyl]-1-methylpyrrolidin-1-ium-1-yl]acetate bromide |
| SMILES | CCOC(=O)C[N+]1(C)CCC[C@H]1COC(=O)Nc1ccccc1-c1ccc(F)c(Cl)c1.[Br-] |
| InChI | InChI=1S/C23H26ClFN2O4.BrH/c1-3-30-22(28)14-27(2)12-6-7-17(27)15-31-23(29)26-21-9-5-4-8-18(21)16-10-11-20(25)19(24)13-16;/h4-5,8-11,13,17H,3,6-7,12,14-15H2,1-2H3;1H/t17-,27?;/m0./s1 |
| InChIKey | UMIJUWUVUCLNFP-QZUYNODXSA-N |
| XLogP | 1.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.83 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|