C18H14F2N2O3 — CID 123863775
ethyl N-[2-(7,8-difluoro-4-oxo-1H-quinolin-2-yl)phenyl]carbamate (PubChem CID 123863775) has the molecular formula C18H14F2N2O3 and a molecular weight of 344.32 g/mol. Its IUPAC name is ethyl N-[2-(7,8-difluoro-4-oxo-1H-quinolin-2-yl)phenyl]carbamate.
| Compound Name | ethyl N-[2-(7,8-difluoro-4-oxo-1H-quinolin-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 123863775 |
| Molecular Formula | C18H14F2N2O3 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | ethyl N-[2-(7,8-difluoro-4-oxo-1H-quinolin-2-yl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccccc1-c1cc(=O)c2ccc(F)c(F)c2[nH]1 |
| InChI | InChI=1S/C18H14F2N2O3/c1-2-25-18(24)22-13-6-4-3-5-10(13)14-9-15(23)11-7-8-12(19)16(20)17(11)21-14/h3-9H,2H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | MMOCNDSLDBQMRC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |