C17H14N2O4 — CID 123162805
ethyl N-[2-(4-oxopyrano[2,3-c]pyridin-2-yl)phenyl]carbamate (PubChem CID 123162805) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is ethyl N-[2-(4-oxopyrano[2,3-c]pyridin-2-yl)phenyl]carbamate.
| Compound Name | ethyl N-[2-(4-oxopyrano[2,3-c]pyridin-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 123162805 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | ethyl N-[2-(4-oxopyrano[2,3-c]pyridin-2-yl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccccc1-c1cc(=O)c2ccncc2o1 |
| InChI | InChI=1S/C17H14N2O4/c1-2-22-17(21)19-13-6-4-3-5-11(13)15-9-14(20)12-7-8-18-10-16(12)23-15/h3-10H,2H2,1H3,(H,19,21) |
| InChIKey | JKJAPSGJPVTUIY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |