C16H13N3O5 — CID 123159842
ethyl N-[2-(3,8-dioxo-4H-pyrano[2,3-b]pyrazin-6-yl)phenyl]carbamate (PubChem CID 123159842) has the molecular formula C16H13N3O5 and a molecular weight of 327.30 g/mol. Its IUPAC name is ethyl N-[2-(3,8-dioxo-4H-pyrano[2,3-b]pyrazin-6-yl)phenyl]carbamate.
| Compound Name | ethyl N-[2-(3,8-dioxo-4H-pyrano[2,3-b]pyrazin-6-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 123159842 |
| Molecular Formula | C16H13N3O5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | ethyl N-[2-(3,8-dioxo-4H-pyrano[2,3-b]pyrazin-6-yl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccccc1-c1cc(=O)c2ncc(=O)[nH]c2o1 |
| InChI | InChI=1S/C16H13N3O5/c1-2-23-16(22)18-10-6-4-3-5-9(10)12-7-11(20)14-15(24-12)19-13(21)8-17-14/h3-8H,2H2,1H3,(H,18,22)(H,19,21) |
| InChIKey | GXMACKGPRLQZLH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |