C18H16N2O5 — CID 123152524
ethyl N-[2-(6,7-dihydroxy-4-oxo-1H-quinolin-2-yl)phenyl]carbamate (PubChem CID 123152524) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is ethyl N-[2-(6,7-dihydroxy-4-oxo-1H-quinolin-2-yl)phenyl]carbamate.
| Compound Name | ethyl N-[2-(6,7-dihydroxy-4-oxo-1H-quinolin-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 123152524 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | ethyl N-[2-(6,7-dihydroxy-4-oxo-1H-quinolin-2-yl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccccc1-c1cc(=O)c2cc(O)c(O)cc2[nH]1 |
| InChI | InChI=1S/C18H16N2O5/c1-2-25-18(24)20-12-6-4-3-5-10(12)13-8-15(21)11-7-16(22)17(23)9-14(11)19-13/h3-9,22-23H,2H2,1H3,(H,19,21)(H,20,24) |
| InChIKey | LSJPNQGOUYBKRS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|