C24H19N3O7 — CID 140506816
[4-(5,7-dihydroxy-4-oxo-1H-quinolin-2-yl)-3-(ethoxycarbonylamino)phenyl] pyridine-3-carboxylate (PubChem CID 140506816) has the molecular formula C24H19N3O7 and a molecular weight of 461.43 g/mol. Its IUPAC name is [4-(5,7-dihydroxy-4-oxo-1H-quinolin-2-yl)-3-(ethoxycarbonylamino)phenyl] pyridine-3-carboxylate.
| Compound Name | [4-(5,7-dihydroxy-4-oxo-1H-quinolin-2-yl)-3-(ethoxycarbonylamino)phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140506816 |
| Molecular Formula | C24H19N3O7 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [4-(5,7-dihydroxy-4-oxo-1H-quinolin-2-yl)-3-(ethoxycarbonylamino)phenyl] pyridine-3-carboxylate |
| SMILES | CCOC(=O)Nc1cc(OC(=O)c2cccnc2)ccc1-c1cc(=O)c2c(O)cc(O)cc2[nH]1 |
| InChI | InChI=1S/C24H19N3O7/c1-2-33-24(32)27-17-10-15(34-23(31)13-4-3-7-25-12-13)5-6-16(17)18-11-21(30)22-19(26-18)8-14(28)9-20(22)29/h3-12,28-29H,2H2,1H3,(H,26,30)(H,27,32) |
| InChIKey | IXAAQSABEWRCMT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|