C18H14F2N2O4 — CID 66649980
ethyl N-[2-(6,7-difluoro-4-oxo-1H-quinolin-2-yl)-5-hydroxyphenyl]carbamate (PubChem CID 66649980) has the molecular formula C18H14F2N2O4 and a molecular weight of 360.32 g/mol. Its IUPAC name is ethyl N-[2-(6,7-difluoro-4-oxo-1H-quinolin-2-yl)-5-hydroxyphenyl]carbamate.
| Compound Name | ethyl N-[2-(6,7-difluoro-4-oxo-1H-quinolin-2-yl)-5-hydroxyphenyl]carbamate |
|---|---|
| PubChem CID | 66649980 |
| Molecular Formula | C18H14F2N2O4 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | ethyl N-[2-(6,7-difluoro-4-oxo-1H-quinolin-2-yl)-5-hydroxyphenyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(O)ccc1-c1cc(=O)c2cc(F)c(F)cc2[nH]1 |
| InChI | InChI=1S/C18H14F2N2O4/c1-2-26-18(25)22-14-5-9(23)3-4-10(14)16-8-17(24)11-6-12(19)13(20)7-15(11)21-16/h3-8,23H,2H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | SICYPRCPHYMHJO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |