C18H15NO4 — CID 155209399
ethyl 2-(4-hydroxyphenyl)-4-oxo-1H-quinoline-6-carboxylate (PubChem CID 155209399) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is ethyl 2-(4-hydroxyphenyl)-4-oxo-1H-quinoline-6-carboxylate.
| Compound Name | ethyl 2-(4-hydroxyphenyl)-4-oxo-1H-quinoline-6-carboxylate |
|---|---|
| PubChem CID | 155209399 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | ethyl 2-(4-hydroxyphenyl)-4-oxo-1H-quinoline-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2[nH]c(-c3ccc(O)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C18H15NO4/c1-2-23-18(22)12-5-8-15-14(9-12)17(21)10-16(19-15)11-3-6-13(20)7-4-11/h3-10,20H,2H2,1H3,(H,19,21) |
| InChIKey | YCOMMNMAUAWGLK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |