C31H29N3O3 — CID 86600381
ethyl 1-cyclohexyl-2-(4-oxo-2-phenyl-1H-quinolin-6-yl)benzimidazole-5-carboxylate (PubChem CID 86600381) has the molecular formula C31H29N3O3 and a molecular weight of 491.59 g/mol. Its IUPAC name is ethyl 1-cyclohexyl-2-(4-oxo-2-phenyl-1H-quinolin-6-yl)benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-cyclohexyl-2-(4-oxo-2-phenyl-1H-quinolin-6-yl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 86600381 |
| Molecular Formula | C31H29N3O3 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | ethyl 1-cyclohexyl-2-(4-oxo-2-phenyl-1H-quinolin-6-yl)benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(-c1ccc3[nH]c(-c4ccccc4)cc(=O)c3c1)n2C1CCCCC1 |
| InChI | InChI=1S/C31H29N3O3/c1-2-37-31(36)22-14-16-28-27(18-22)33-30(34(28)23-11-7-4-8-12-23)21-13-15-25-24(17-21)29(35)19-26(32-25)20-9-5-3-6-10-20/h3,5-6,9-10,13-19,23H,2,4,7-8,11-12H2,1H3,(H,32,35) |
| InChIKey | WVCHOGOMBQLGPE-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |