C11H11NO3S — CID 15381204
ethyl N-(6-hydroxy-1-benzothiophen-3-yl)carbamate (PubChem CID 15381204) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is ethyl N-(6-hydroxy-1-benzothiophen-3-yl)carbamate.
| Compound Name | ethyl N-(6-hydroxy-1-benzothiophen-3-yl)carbamate |
|---|---|
| PubChem CID | 15381204 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | ethyl N-(6-hydroxy-1-benzothiophen-3-yl)carbamate |
| SMILES | CCOC(=O)Nc1csc2cc(O)ccc12 |
| InChI | InChI=1S/C11H11NO3S/c1-2-15-11(14)12-9-6-16-10-5-7(13)3-4-8(9)10/h3-6,13H,2H2,1H3,(H,12,14) |
| InChIKey | LFUKAWNPCCNISL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |