About ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one
ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one (PubChem CID 16640233) has the molecular formula C11H18N2O3S
and a molecular weight of 258.34 g/mol. Its IUPAC name is ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one.
Molecular Properties
| Compound Name | ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one |
| PubChem CID | 16640233 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one |
| SMILES | CC(C)=O.CCOC(=O)Nc1ccsc1NC |
| InChI | InChI=1S/C8H12N2O2S.C3H6O/c1-3-12-8(11)10-6-4-5-13-7(6)9-2;1-3(2)4/h4-5,9H,3H2,1-2H3,(H,10,11);1-2H3 |
| InChIKey | SHYMCHLYEYYHJD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one?
The IUPAC name of ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one (CID 16640233) is ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one.
What is the SMILES notation for ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one?
The canonical SMILES for ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one is CC(C)=O.CCOC(=O)Nc1ccsc1NC.
What is the InChIKey of ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one?
The InChIKey is SHYMCHLYEYYHJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S.C3H6O/c1-3-12-8(11)10-6-4-5-13-7(6)9-2;1-3(2)4/h4-5,9H,3H2,1-2H3,(H,10,11);1-2H3.
What are the key properties of ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one?
ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one has a molecular weight of 258.34 g/mol, XLogP of 2.95, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[2-(methylamino)thiophen-3-yl]carbamate;propan-2-one is sourced from PubChem (CID 16640233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).