C11H18N2O2S — CID 170888901
ethyl N-[2-(2-aminobutyl)thiophen-3-yl]carbamate (PubChem CID 170888901) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is ethyl N-[2-(2-aminobutyl)thiophen-3-yl]carbamate.
| Compound Name | ethyl N-[2-(2-aminobutyl)thiophen-3-yl]carbamate |
|---|---|
| PubChem CID | 170888901 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | ethyl N-[2-(2-aminobutyl)thiophen-3-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccsc1CC(N)CC |
| InChI | InChI=1S/C11H18N2O2S/c1-3-8(12)7-10-9(5-6-16-10)13-11(14)15-4-2/h5-6,8H,3-4,7,12H2,1-2H3,(H,13,14) |
| InChIKey | YLJHXFIEVYVWAF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |