C19H15FN2O6 — CID 143220012
2-[2-(ethoxycarbonylamino)-4-hydroxyphenyl]-7-fluoro-4-oxoquinoline-1-carboxylic acid (PubChem CID 143220012) has the molecular formula C19H15FN2O6 and a molecular weight of 386.34 g/mol. Its IUPAC name is 2-[2-(ethoxycarbonylamino)-4-hydroxyphenyl]-7-fluoro-4-oxoquinoline-1-carboxylic acid.
| Compound Name | 2-[2-(ethoxycarbonylamino)-4-hydroxyphenyl]-7-fluoro-4-oxoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 143220012 |
| Molecular Formula | C19H15FN2O6 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-[2-(ethoxycarbonylamino)-4-hydroxyphenyl]-7-fluoro-4-oxoquinoline-1-carboxylic acid |
| SMILES | CCOC(=O)Nc1cc(O)ccc1-c1cc(=O)c2ccc(F)cc2n1C(=O)O |
| InChI | InChI=1S/C19H15FN2O6/c1-2-28-18(25)21-14-8-11(23)4-6-12(14)16-9-17(24)13-5-3-10(20)7-15(13)22(16)19(26)27/h3-9,23H,2H2,1H3,(H,21,25)(H,26,27) |
| InChIKey | OKSPMLAMECFJAO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |