C18H16N2O6 — CID 66649868
ethyl N-[2-(5,6-dihydroxy-4-oxo-1H-quinolin-2-yl)-5-hydroxyphenyl]carbamate (PubChem CID 66649868) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is ethyl N-[2-(5,6-dihydroxy-4-oxo-1H-quinolin-2-yl)-5-hydroxyphenyl]carbamate.
| Compound Name | ethyl N-[2-(5,6-dihydroxy-4-oxo-1H-quinolin-2-yl)-5-hydroxyphenyl]carbamate |
|---|---|
| PubChem CID | 66649868 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | ethyl N-[2-(5,6-dihydroxy-4-oxo-1H-quinolin-2-yl)-5-hydroxyphenyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(O)ccc1-c1cc(=O)c2c(O)c(O)ccc2[nH]1 |
| InChI | InChI=1S/C18H16N2O6/c1-2-26-18(25)20-12-7-9(21)3-4-10(12)13-8-15(23)16-11(19-13)5-6-14(22)17(16)24/h3-8,21-22,24H,2H2,1H3,(H,19,23)(H,20,25) |
| InChIKey | KPAVSSUPPVERQD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|