C24H17FN2O6 — CID 140506704
[3-(ethoxycarbonylamino)-5-fluoro-4-(4-oxochromen-2-yl)phenyl] pyridine-3-carboxylate (PubChem CID 140506704) has the molecular formula C24H17FN2O6 and a molecular weight of 448.41 g/mol. Its IUPAC name is [3-(ethoxycarbonylamino)-5-fluoro-4-(4-oxochromen-2-yl)phenyl] pyridine-3-carboxylate.
| Compound Name | [3-(ethoxycarbonylamino)-5-fluoro-4-(4-oxochromen-2-yl)phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140506704 |
| Molecular Formula | C24H17FN2O6 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | [3-(ethoxycarbonylamino)-5-fluoro-4-(4-oxochromen-2-yl)phenyl] pyridine-3-carboxylate |
| SMILES | CCOC(=O)Nc1cc(OC(=O)c2cccnc2)cc(F)c1-c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C24H17FN2O6/c1-2-31-24(30)27-18-11-15(32-23(29)14-6-5-9-26-13-14)10-17(25)22(18)21-12-19(28)16-7-3-4-8-20(16)33-21/h3-13H,2H2,1H3,(H,27,30) |
| InChIKey | PZGJZGSEJQQUBG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|