C24H18N2O8 — CID 140506848
[4-(5,7-dihydroxy-4-oxochromen-2-yl)-3-(ethoxycarbonylamino)phenyl] pyridine-3-carboxylate (PubChem CID 140506848) has the molecular formula C24H18N2O8 and a molecular weight of 462.41 g/mol. Its IUPAC name is [4-(5,7-dihydroxy-4-oxochromen-2-yl)-3-(ethoxycarbonylamino)phenyl] pyridine-3-carboxylate.
| Compound Name | [4-(5,7-dihydroxy-4-oxochromen-2-yl)-3-(ethoxycarbonylamino)phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140506848 |
| Molecular Formula | C24H18N2O8 |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | [4-(5,7-dihydroxy-4-oxochromen-2-yl)-3-(ethoxycarbonylamino)phenyl] pyridine-3-carboxylate |
| SMILES | CCOC(=O)Nc1cc(OC(=O)c2cccnc2)ccc1-c1cc(=O)c2c(O)cc(O)cc2o1 |
| InChI | InChI=1S/C24H18N2O8/c1-2-32-24(31)26-17-10-15(33-23(30)13-4-3-7-25-12-13)5-6-16(17)20-11-19(29)22-18(28)8-14(27)9-21(22)34-20/h3-12,27-28H,2H2,1H3,(H,26,31) |
| InChIKey | WXCSEEFKEVYGHQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 148.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|