C23H17N3O7 — CID 140506693
[3-(ethoxycarbonylamino)-5-hydroxy-4-(4-oxopyrano[2,3-c]pyridin-2-yl)phenyl] pyridine-3-carboxylate (PubChem CID 140506693) has the molecular formula C23H17N3O7 and a molecular weight of 447.40 g/mol. Its IUPAC name is [3-(ethoxycarbonylamino)-5-hydroxy-4-(4-oxopyrano[2,3-c]pyridin-2-yl)phenyl] pyridine-3-carboxylate.
| Compound Name | [3-(ethoxycarbonylamino)-5-hydroxy-4-(4-oxopyrano[2,3-c]pyridin-2-yl)phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140506693 |
| Molecular Formula | C23H17N3O7 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | [3-(ethoxycarbonylamino)-5-hydroxy-4-(4-oxopyrano[2,3-c]pyridin-2-yl)phenyl] pyridine-3-carboxylate |
| SMILES | CCOC(=O)Nc1cc(OC(=O)c2cccnc2)cc(O)c1-c1cc(=O)c2ccncc2o1 |
| InChI | InChI=1S/C23H17N3O7/c1-2-31-23(30)26-16-8-14(32-22(29)13-4-3-6-24-11-13)9-18(28)21(16)19-10-17(27)15-5-7-25-12-20(15)33-19/h3-12,28H,2H2,1H3,(H,26,30) |
| InChIKey | GXWCCZJLCIBVFI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|