C19H27N5O3 — CID 121427026
tert-butyl N-[2-[ethyl-[2-(triazol-2-yl)benzoyl]amino]ethyl]-N-methylcarbamate (PubChem CID 121427026) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is tert-butyl N-[2-[ethyl-[2-(triazol-2-yl)benzoyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[ethyl-[2-(triazol-2-yl)benzoyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 121427026 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | tert-butyl N-[2-[ethyl-[2-(triazol-2-yl)benzoyl]amino]ethyl]-N-methylcarbamate |
| SMILES | CCN(CCN(C)C(=O)OC(C)(C)C)C(=O)c1ccccc1-n1nccn1 |
| InChI | InChI=1S/C19H27N5O3/c1-6-23(14-13-22(5)18(26)27-19(2,3)4)17(25)15-9-7-8-10-16(15)24-20-11-12-21-24/h7-12H,6,13-14H2,1-5H3 |
| InChIKey | OIWCKANJMMWJAB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |