C20H24N6O2 — CID 121413939
N-ethyl-N-[2-[5-(2-hydroxypropan-2-yl)pyrimidin-2-yl]ethyl]-2-(triazol-2-yl)benzamide (PubChem CID 121413939) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-ethyl-N-[2-[5-(2-hydroxypropan-2-yl)pyrimidin-2-yl]ethyl]-2-(triazol-2-yl)benzamide.
| Compound Name | N-ethyl-N-[2-[5-(2-hydroxypropan-2-yl)pyrimidin-2-yl]ethyl]-2-(triazol-2-yl)benzamide |
|---|---|
| PubChem CID | 121413939 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-ethyl-N-[2-[5-(2-hydroxypropan-2-yl)pyrimidin-2-yl]ethyl]-2-(triazol-2-yl)benzamide |
| SMILES | CCN(CCc1ncc(C(C)(C)O)cn1)C(=O)c1ccccc1-n1nccn1 |
| InChI | InChI=1S/C20H24N6O2/c1-4-25(12-9-18-21-13-15(14-22-18)20(2,3)28)19(27)16-7-5-6-8-17(16)26-23-10-11-24-26/h5-8,10-11,13-14,28H,4,9,12H2,1-3H3 |
| InChIKey | GOUIOZCBXPXEIB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |