C20H27N6O2+ — CID 145100115
[(2Z)-2-[[2-[ethyl-[2-[5-(2-hydroxypropan-2-yl)pyrimidin-2-yl]ethyl]carbamoyl]phenyl]hydrazinylidene]ethylidene]azanium (PubChem CID 145100115) has the molecular formula C20H27N6O2+ and a molecular weight of 383.48 g/mol. Its IUPAC name is [(2Z)-2-[[2-[ethyl-[2-[5-(2-hydroxypropan-2-yl)pyrimidin-2-yl]ethyl]carbamoyl]phenyl]hydrazinylidene]ethylidene]azanium.
| Compound Name | [(2Z)-2-[[2-[ethyl-[2-[5-(2-hydroxypropan-2-yl)pyrimidin-2-yl]ethyl]carbamoyl]phenyl]hydrazinylidene]ethylidene]azanium |
|---|---|
| PubChem CID | 145100115 |
| Molecular Formula | C20H27N6O2+ |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | [(2Z)-2-[[2-[ethyl-[2-[5-(2-hydroxypropan-2-yl)pyrimidin-2-yl]ethyl]carbamoyl]phenyl]hydrazinylidene]ethylidene]azanium |
| SMILES | CCN(CCc1ncc(C(C)(C)O)cn1)C(=O)c1ccccc1N/N=C\C=[NH2+] |
| InChI | InChI=1S/C20H26N6O2/c1-4-26(12-9-18-22-13-15(14-23-18)20(2,3)28)19(27)16-7-5-6-8-17(16)25-24-11-10-21/h5-8,10-11,13-14,21,25,28H,4,9,12H2,1-3H3/p+1/b21-10?,24-11- |
| InChIKey | GIAGHFQYJYUDQT-FKHZBJISSA-O |
| XLogP | 0.64 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|