C25H30FNO2 — CID 121427054
4-[cyclohexylidene-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]methyl]phenol (PubChem CID 121427054) has the molecular formula C25H30FNO2 and a molecular weight of 395.52 g/mol. Its IUPAC name is 4-[cyclohexylidene-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]methyl]phenol.
| Compound Name | 4-[cyclohexylidene-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]methyl]phenol |
|---|---|
| PubChem CID | 121427054 |
| Molecular Formula | C25H30FNO2 |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 4-[cyclohexylidene-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]methyl]phenol |
| SMILES | Oc1ccc(C(=C2CCCCC2)c2ccc(OCCN3CC(CF)C3)cc2)cc1 |
| InChI | InChI=1S/C25H30FNO2/c26-16-19-17-27(18-19)14-15-29-24-12-8-22(9-13-24)25(20-4-2-1-3-5-20)21-6-10-23(28)11-7-21/h6-13,19,28H,1-5,14-18H2 |
| InChIKey | DGRFBBAXBNMKSS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |