About hexan-3-yl 2-(iodomethyl)butanoate
hexan-3-yl 2-(iodomethyl)butanoate (PubChem CID 121429214) has the molecular formula C11H21IO2
and a molecular weight of 312.19 g/mol. Its IUPAC name is hexan-3-yl 2-(iodomethyl)butanoate.
Molecular Properties
| Compound Name | hexan-3-yl 2-(iodomethyl)butanoate |
| PubChem CID | 121429214 |
| Molecular Formula | C11H21IO2 |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | hexan-3-yl 2-(iodomethyl)butanoate |
| SMILES | CCCC(CC)OC(=O)C(CC)CI |
| InChI | InChI=1S/C11H21IO2/c1-4-7-10(6-3)14-11(13)9(5-2)8-12/h9-10H,4-8H2,1-3H3 |
| InChIKey | QBEGIWPUGHPLGY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze hexan-3-yl 2-(iodomethyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-3-yl 2-(iodomethyl)butanoate?
The IUPAC name of hexan-3-yl 2-(iodomethyl)butanoate (CID 121429214) is hexan-3-yl 2-(iodomethyl)butanoate.
What is the SMILES notation for hexan-3-yl 2-(iodomethyl)butanoate?
The canonical SMILES for hexan-3-yl 2-(iodomethyl)butanoate is CCCC(CC)OC(=O)C(CC)CI.
What is the InChIKey of hexan-3-yl 2-(iodomethyl)butanoate?
The InChIKey is QBEGIWPUGHPLGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21IO2/c1-4-7-10(6-3)14-11(13)9(5-2)8-12/h9-10H,4-8H2,1-3H3.
What are the key properties of hexan-3-yl 2-(iodomethyl)butanoate?
hexan-3-yl 2-(iodomethyl)butanoate has a molecular weight of 312.19 g/mol, XLogP of 3.57, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-3-yl 2-(iodomethyl)butanoate is sourced from PubChem (CID 121429214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).