C13H21N3 — CID 121430066
4-N-methyl-4-N-(4-methylpiperidin-4-yl)benzene-1,4-diamine (PubChem CID 121430066) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-N-methyl-4-N-(4-methylpiperidin-4-yl)benzene-1,4-diamine.
| Compound Name | 4-N-methyl-4-N-(4-methylpiperidin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 121430066 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 4-N-methyl-4-N-(4-methylpiperidin-4-yl)benzene-1,4-diamine |
| SMILES | CN(c1ccc(N)cc1)C1(C)CCNCC1 |
| InChI | InChI=1S/C13H21N3/c1-13(7-9-15-10-8-13)16(2)12-5-3-11(14)4-6-12/h3-6,15H,7-10,14H2,1-2H3 |
| InChIKey | ATRLOODAEGGJMB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|