C11H14FN5O4 — CID 121430146
1-[(2R,3S,4R,5R)-5-(azidomethyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methylidenepyrimidin-4-one (PubChem CID 121430146) has the molecular formula C11H14FN5O4 and a molecular weight of 299.26 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-5-(azidomethyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methylidenepyrimidin-4-one.
| Compound Name | 1-[(2R,3S,4R,5R)-5-(azidomethyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 121430146 |
| Molecular Formula | C11H14FN5O4 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-5-(azidomethyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methylidenepyrimidin-4-one |
| SMILES | C=C1NC(=O)C=CN1[C@@H]1O[C@@](CO)(CN=[N+]=[N-])[C@@H](O)[C@@H]1F |
| InChI | InChI=1S/C11H14FN5O4/c1-6-15-7(19)2-3-17(6)10-8(12)9(20)11(5-18,21-10)4-14-16-13/h2-3,8-10,18,20H,1,4-5H2,(H,15,19)/t8-,9-,10+,11+/m0/s1 |
| InChIKey | DVWGFOAZCOATKQ-UKKRHICBSA-N |
| XLogP | -0.50 |
| TPSA | 130.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|