C23H29NO4S — CID 121432704
6-butoxy-7-methoxy-1-[(E)-2-(3-methylsulfonylphenyl)ethenyl]-1,2,3,4-tetrahydroisoquinoline (PubChem CID 121432704) has the molecular formula C23H29NO4S and a molecular weight of 415.56 g/mol. Its IUPAC name is 6-butoxy-7-methoxy-1-[(E)-2-(3-methylsulfonylphenyl)ethenyl]-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6-butoxy-7-methoxy-1-[(E)-2-(3-methylsulfonylphenyl)ethenyl]-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 121432704 |
| Molecular Formula | C23H29NO4S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 6-butoxy-7-methoxy-1-[(E)-2-(3-methylsulfonylphenyl)ethenyl]-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCCCOc1cc2c(cc1OC)C(/C=C/c1cccc(S(C)(=O)=O)c1)NCC2 |
| InChI | InChI=1S/C23H29NO4S/c1-4-5-13-28-23-15-18-11-12-24-21(20(18)16-22(23)27-2)10-9-17-7-6-8-19(14-17)29(3,25)26/h6-10,14-16,21,24H,4-5,11-13H2,1-3H3/b10-9+ |
| InChIKey | SEWQGOLVWSVKAR-MDZDMXLPSA-N |
| XLogP | 4.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|