C27H37NO2 — CID 121432762
6-butoxy-1-[(E)-2-(2,4-dimethyl-5-propan-2-ylphenyl)ethenyl]-7-methoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 121432762) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 6-butoxy-1-[(E)-2-(2,4-dimethyl-5-propan-2-ylphenyl)ethenyl]-7-methoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6-butoxy-1-[(E)-2-(2,4-dimethyl-5-propan-2-ylphenyl)ethenyl]-7-methoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 121432762 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 6-butoxy-1-[(E)-2-(2,4-dimethyl-5-propan-2-ylphenyl)ethenyl]-7-methoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCCCOc1cc2c(cc1OC)C(/C=C/c1cc(C(C)C)c(C)cc1C)NCC2 |
| InChI | InChI=1S/C27H37NO2/c1-7-8-13-30-27-16-22-11-12-28-25(24(22)17-26(27)29-6)10-9-21-15-23(18(2)3)20(5)14-19(21)4/h9-10,14-18,25,28H,7-8,11-13H2,1-6H3/b10-9+ |
| InChIKey | RGKJLQPUFMIQCW-MDZDMXLPSA-N |
| XLogP | 6.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|