C14H12ClF3N4O4S — CID 121435065
[5-[(3-chlorophenyl)carbamoyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl] trifluoromethanesulfonate (PubChem CID 121435065) has the molecular formula C14H12ClF3N4O4S and a molecular weight of 424.79 g/mol. Its IUPAC name is [5-[(3-chlorophenyl)carbamoyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl] trifluoromethanesulfonate.
| Compound Name | [5-[(3-chlorophenyl)carbamoyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 121435065 |
| Molecular Formula | C14H12ClF3N4O4S |
| Molecular Weight | 424.79 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | [5-[(3-chlorophenyl)carbamoyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl] trifluoromethanesulfonate |
| SMILES | O=C(Nc1cccc(Cl)c1)N1CCc2[nH]nc(OS(=O)(=O)C(F)(F)F)c2C1 |
| InChI | InChI=1S/C14H12ClF3N4O4S/c15-8-2-1-3-9(6-8)19-13(23)22-5-4-11-10(7-22)12(21-20-11)26-27(24,25)14(16,17)18/h1-3,6H,4-5,7H2,(H,19,23)(H,20,21) |
| InChIKey | KDXWUTTZHZYDDV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|