About 5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione
5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione (PubChem CID 121437299) has the molecular formula C14H14ClFN2O3
and a molecular weight of 312.73 g/mol. Its IUPAC name is 5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione |
| PubChem CID | 121437299 |
| Molecular Formula | C14H14ClFN2O3 |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione |
| SMILES | COC[C@H](C)n1c(=O)[nH]cc(-c2cccc(F)c2Cl)c1=O |
| InChI | InChI=1S/C14H14ClFN2O3/c1-8(7-21-2)18-13(19)10(6-17-14(18)20)9-4-3-5-11(16)12(9)15/h3-6,8H,7H2,1-2H3,(H,17,20)/t8-/m0/s1 |
| InChIKey | WPMYPYVPMFFUKL-QMMMGPOBSA-N |
| XLogP | 2.20 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione?
The IUPAC name of 5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione (CID 121437299) is 5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione?
The canonical SMILES for 5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione is COC[C@H](C)n1c(=O)[nH]cc(-c2cccc(F)c2Cl)c1=O.
What is the InChIKey of 5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione?
The InChIKey is WPMYPYVPMFFUKL-QMMMGPOBSA-N. The full InChI is InChI=1S/C14H14ClFN2O3/c1-8(7-21-2)18-13(19)10(6-17-14(18)20)9-4-3-5-11(16)12(9)15/h3-6,8H,7H2,1-2H3,(H,17,20)/t8-/m0/s1.
What are the key properties of 5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione?
5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione has a molecular weight of 312.73 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chloro-3-fluorophenyl)-3-[(2S)-1-methoxypropan-2-yl]-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 121437299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).